C21H48O2 — CID 160854637
ethylperoxyethane;3-methylheptane;2,2,4-trimethylhexane (PubChem CID 160854637) has the molecular formula C21H48O2 and a molecular weight of 332.61 g/mol. Its IUPAC name is ethylperoxyethane;3-methylheptane;2,2,4-trimethylhexane.
| Compound Name | ethylperoxyethane;3-methylheptane;2,2,4-trimethylhexane |
|---|---|
| PubChem CID | 160854637 |
| Molecular Formula | C21H48O2 |
| Molecular Weight | 332.61 g/mol |
| Exact Mass | 332.37 |
| IUPAC Name | ethylperoxyethane;3-methylheptane;2,2,4-trimethylhexane |
| SMILES | CCC(C)CC(C)(C)C.CCCCC(C)CC.CCOOCC |
| InChI | InChI=1S/C9H20.C8H18.C4H10O2/c1-6-8(2)7-9(3,4)5;1-4-6-7-8(3)5-2;1-3-5-6-4-2/h8H,6-7H2,1-5H3;8H,4-7H2,1-3H3;3-4H2,1-2H3 |
| InChIKey | SJRZKDBORVRVSP-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.61 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|