C21H46 — CID 159606053
4-ethyl-2,2-dimethyloctane;2,2,4-trimethylhexane (PubChem CID 159606053) has the molecular formula C21H46 and a molecular weight of 298.60 g/mol. Its IUPAC name is 4-ethyl-2,2-dimethyloctane;2,2,4-trimethylhexane.
| Compound Name | 4-ethyl-2,2-dimethyloctane;2,2,4-trimethylhexane |
|---|---|
| PubChem CID | 159606053 |
| Molecular Formula | C21H46 |
| Molecular Weight | 298.60 g/mol |
| Exact Mass | 298.36 |
| IUPAC Name | 4-ethyl-2,2-dimethyloctane;2,2,4-trimethylhexane |
| SMILES | CCC(C)CC(C)(C)C.CCCCC(CC)CC(C)(C)C |
| InChI | InChI=1S/C12H26.C9H20/c1-6-8-9-11(7-2)10-12(3,4)5;1-6-8(2)7-9(3,4)5/h11H,6-10H2,1-5H3;8H,6-7H2,1-5H3 |
| InChIKey | MMCBPHOOHDRNSS-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.60 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |