C17H36O — CID 19788763
8-ethyl-2,2,4-trimethyldodecan-6-ol (PubChem CID 19788763) has the molecular formula C17H36O and a molecular weight of 256.47 g/mol. Its IUPAC name is 8-ethyl-2,2,4-trimethyldodecan-6-ol.
| Compound Name | 8-ethyl-2,2,4-trimethyldodecan-6-ol |
|---|---|
| PubChem CID | 19788763 |
| Molecular Formula | C17H36O |
| Molecular Weight | 256.47 g/mol |
| Exact Mass | 256.28 |
| IUPAC Name | 8-ethyl-2,2,4-trimethyldodecan-6-ol |
| SMILES | CCCCC(CC)CC(O)CC(C)CC(C)(C)C |
| InChI | InChI=1S/C17H36O/c1-7-9-10-15(8-2)12-16(18)11-14(3)13-17(4,5)6/h14-16,18H,7-13H2,1-6H3 |
| InChIKey | XIXZRVFQPMXYFK-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.47 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |