C15H32O — CID 115789018
2,2,4,8-tetramethylundecan-6-ol (PubChem CID 115789018) has the molecular formula C15H32O and a molecular weight of 228.42 g/mol. Its IUPAC name is 2,2,4,8-tetramethylundecan-6-ol.
| Compound Name | 2,2,4,8-tetramethylundecan-6-ol |
|---|---|
| PubChem CID | 115789018 |
| Molecular Formula | C15H32O |
| Molecular Weight | 228.42 g/mol |
| Exact Mass | 228.25 |
| IUPAC Name | 2,2,4,8-tetramethylundecan-6-ol |
| SMILES | CCCC(C)CC(O)CC(C)CC(C)(C)C |
| InChI | InChI=1S/C15H32O/c1-7-8-12(2)9-14(16)10-13(3)11-15(4,5)6/h12-14,16H,7-11H2,1-6H3 |
| InChIKey | WPEUOIXKLILICF-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.42 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |