C13H28O3S — CID 115780204
6,8,8-trimethyl-1-methylsulfonylnonan-4-ol (PubChem CID 115780204) has the molecular formula C13H28O3S and a molecular weight of 264.43 g/mol. Its IUPAC name is 6,8,8-trimethyl-1-methylsulfonylnonan-4-ol.
| Compound Name | 6,8,8-trimethyl-1-methylsulfonylnonan-4-ol |
|---|---|
| PubChem CID | 115780204 |
| Molecular Formula | C13H28O3S |
| Molecular Weight | 264.43 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 6,8,8-trimethyl-1-methylsulfonylnonan-4-ol |
| SMILES | CC(CC(O)CCCS(C)(=O)=O)CC(C)(C)C |
| InChI | InChI=1S/C13H28O3S/c1-11(10-13(2,3)4)9-12(14)7-6-8-17(5,15)16/h11-12,14H,6-10H2,1-5H3 |
| InChIKey | PLWHRMSTAVRIBM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |