C13H29NO2S — CID 115848597
N,5,7,7-tetramethyl-1-methylsulfonyloctan-3-amine (PubChem CID 115848597) has the molecular formula C13H29NO2S and a molecular weight of 263.45 g/mol. Its IUPAC name is N,5,7,7-tetramethyl-1-methylsulfonyloctan-3-amine.
| Compound Name | N,5,7,7-tetramethyl-1-methylsulfonyloctan-3-amine |
|---|---|
| PubChem CID | 115848597 |
| Molecular Formula | C13H29NO2S |
| Molecular Weight | 263.45 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | N,5,7,7-tetramethyl-1-methylsulfonyloctan-3-amine |
| SMILES | CNC(CCS(C)(=O)=O)CC(C)CC(C)(C)C |
| InChI | InChI=1S/C13H29NO2S/c1-11(10-13(2,3)4)9-12(14-5)7-8-17(6,15)16/h11-12,14H,7-10H2,1-6H3 |
| InChIKey | LBNBOXQVAPVZLV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.45 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |