C15H33NO2S — CID 115848596
5,7,7-trimethyl-1-methylsulfonyl-N-propyloctan-3-amine (PubChem CID 115848596) has the molecular formula C15H33NO2S and a molecular weight of 291.50 g/mol. Its IUPAC name is 5,7,7-trimethyl-1-methylsulfonyl-N-propyloctan-3-amine.
| Compound Name | 5,7,7-trimethyl-1-methylsulfonyl-N-propyloctan-3-amine |
|---|---|
| PubChem CID | 115848596 |
| Molecular Formula | C15H33NO2S |
| Molecular Weight | 291.50 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | 5,7,7-trimethyl-1-methylsulfonyl-N-propyloctan-3-amine |
| SMILES | CCCNC(CCS(C)(=O)=O)CC(C)CC(C)(C)C |
| InChI | InChI=1S/C15H33NO2S/c1-7-9-16-14(8-10-19(6,17)18)11-13(2)12-15(3,4)5/h13-14,16H,7-12H2,1-6H3 |
| InChIKey | UKYVRAAXEZEREP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.50 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |