C16H30N2S — CID 105015268
4,6,6-trimethyl-N-propyl-1-(1,3-thiazol-2-yl)heptan-2-amine (PubChem CID 105015268) has the molecular formula C16H30N2S and a molecular weight of 282.50 g/mol. Its IUPAC name is 4,6,6-trimethyl-N-propyl-1-(1,3-thiazol-2-yl)heptan-2-amine.
| Compound Name | 4,6,6-trimethyl-N-propyl-1-(1,3-thiazol-2-yl)heptan-2-amine |
|---|---|
| PubChem CID | 105015268 |
| Molecular Formula | C16H30N2S |
| Molecular Weight | 282.50 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 4,6,6-trimethyl-N-propyl-1-(1,3-thiazol-2-yl)heptan-2-amine |
| SMILES | CCCNC(Cc1nccs1)CC(C)CC(C)(C)C |
| InChI | InChI=1S/C16H30N2S/c1-6-7-17-14(11-15-18-8-9-19-15)10-13(2)12-16(3,4)5/h8-9,13-14,17H,6-7,10-12H2,1-5H3 |
| InChIKey | IUGZSMKOIJODQP-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.50 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |