C17H32N2S — CID 105015117
N-propyl-1-(1,3-thiazol-2-yl)undecan-2-amine (PubChem CID 105015117) has the molecular formula C17H32N2S and a molecular weight of 296.52 g/mol. Its IUPAC name is N-propyl-1-(1,3-thiazol-2-yl)undecan-2-amine.
| Compound Name | N-propyl-1-(1,3-thiazol-2-yl)undecan-2-amine |
|---|---|
| PubChem CID | 105015117 |
| Molecular Formula | C17H32N2S |
| Molecular Weight | 296.52 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | N-propyl-1-(1,3-thiazol-2-yl)undecan-2-amine |
| SMILES | CCCCCCCCCC(Cc1nccs1)NCCC |
| InChI | InChI=1S/C17H32N2S/c1-3-5-6-7-8-9-10-11-16(18-12-4-2)15-17-19-13-14-20-17/h13-14,16,18H,3-12,15H2,1-2H3 |
| InChIKey | KCFDNDLPJJWAIU-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.52 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|