C11H20N2S — CID 105015264
N-methyl-1-(1,3-thiazol-2-yl)heptan-2-amine (PubChem CID 105015264) has the molecular formula C11H20N2S and a molecular weight of 212.36 g/mol. Its IUPAC name is N-methyl-1-(1,3-thiazol-2-yl)heptan-2-amine.
| Compound Name | N-methyl-1-(1,3-thiazol-2-yl)heptan-2-amine |
|---|---|
| PubChem CID | 105015264 |
| Molecular Formula | C11H20N2S |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | N-methyl-1-(1,3-thiazol-2-yl)heptan-2-amine |
| SMILES | CCCCCC(Cc1nccs1)NC |
| InChI | InChI=1S/C11H20N2S/c1-3-4-5-6-10(12-2)9-11-13-7-8-14-11/h7-8,10,12H,3-6,9H2,1-2H3 |
| InChIKey | VPPAWUAQSBSTBO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|