C7H12N2S2 — CID 20699494
2-(methylamino)-3-(1,3-thiazol-2-yl)propane-1-thiol (PubChem CID 20699494) has the molecular formula C7H12N2S2 and a molecular weight of 188.32 g/mol. Its IUPAC name is 2-(methylamino)-3-(1,3-thiazol-2-yl)propane-1-thiol.
| Compound Name | 2-(methylamino)-3-(1,3-thiazol-2-yl)propane-1-thiol |
|---|---|
| PubChem CID | 20699494 |
| Molecular Formula | C7H12N2S2 |
| Molecular Weight | 188.32 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | 2-(methylamino)-3-(1,3-thiazol-2-yl)propane-1-thiol |
| SMILES | CNC(CS)Cc1nccs1 |
| InChI | InChI=1S/C7H12N2S2/c1-8-6(5-10)4-7-9-2-3-11-7/h2-3,6,8,10H,4-5H2,1H3 |
| InChIKey | CHVXXVFGAGLCOQ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.32 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|