C12H20N2OS — CID 105014941
N-methyl-4-(oxolan-2-yl)-1-(1,3-thiazol-2-yl)butan-2-amine (PubChem CID 105014941) has the molecular formula C12H20N2OS and a molecular weight of 240.37 g/mol. Its IUPAC name is N-methyl-4-(oxolan-2-yl)-1-(1,3-thiazol-2-yl)butan-2-amine.
| Compound Name | N-methyl-4-(oxolan-2-yl)-1-(1,3-thiazol-2-yl)butan-2-amine |
|---|---|
| PubChem CID | 105014941 |
| Molecular Formula | C12H20N2OS |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | N-methyl-4-(oxolan-2-yl)-1-(1,3-thiazol-2-yl)butan-2-amine |
| SMILES | CNC(CCC1CCCO1)Cc1nccs1 |
| InChI | InChI=1S/C12H20N2OS/c1-13-10(9-12-14-6-8-16-12)4-5-11-3-2-7-15-11/h6,8,10-11,13H,2-5,7,9H2,1H3 |
| InChIKey | DLYYZOSAHSVQDJ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |