C7H11NS2 — CID 59948549
(2R)-2-methyl-3-(1,3-thiazol-2-yl)propane-1-thiol (PubChem CID 59948549) has the molecular formula C7H11NS2 and a molecular weight of 173.31 g/mol. Its IUPAC name is (2R)-2-methyl-3-(1,3-thiazol-2-yl)propane-1-thiol.
| Compound Name | (2R)-2-methyl-3-(1,3-thiazol-2-yl)propane-1-thiol |
|---|---|
| PubChem CID | 59948549 |
| Molecular Formula | C7H11NS2 |
| Molecular Weight | 173.31 g/mol |
| Exact Mass | 173.03 |
| IUPAC Name | (2R)-2-methyl-3-(1,3-thiazol-2-yl)propane-1-thiol |
| SMILES | C[C@@H](CS)Cc1nccs1 |
| InChI | InChI=1S/C7H11NS2/c1-6(5-9)4-7-8-2-3-10-7/h2-3,6,9H,4-5H2,1H3/t6-/m1/s1 |
| InChIKey | QDWAWDDMQRZESC-ZCFIWIBFSA-N |
| XLogP | 2.25 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|