C10H18N2S — CID 105015255
3-ethyl-1-(1,3-thiazol-2-yl)pentan-2-amine (PubChem CID 105015255) has the molecular formula C10H18N2S and a molecular weight of 198.33 g/mol. Its IUPAC name is 3-ethyl-1-(1,3-thiazol-2-yl)pentan-2-amine.
| Compound Name | 3-ethyl-1-(1,3-thiazol-2-yl)pentan-2-amine |
|---|---|
| PubChem CID | 105015255 |
| Molecular Formula | C10H18N2S |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 3-ethyl-1-(1,3-thiazol-2-yl)pentan-2-amine |
| SMILES | CCC(CC)C(N)Cc1nccs1 |
| InChI | InChI=1S/C10H18N2S/c1-3-8(4-2)9(11)7-10-12-5-6-13-10/h5-6,8-9H,3-4,7,11H2,1-2H3 |
| InChIKey | CWEZNEOWRFSYGD-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |