C9H13NO2S — CID 79823968
methyl 2-(1,3-thiazol-2-ylmethyl)butanoate (PubChem CID 79823968) has the molecular formula C9H13NO2S and a molecular weight of 199.28 g/mol. Its IUPAC name is methyl 2-(1,3-thiazol-2-ylmethyl)butanoate.
| Compound Name | methyl 2-(1,3-thiazol-2-ylmethyl)butanoate |
|---|---|
| PubChem CID | 79823968 |
| Molecular Formula | C9H13NO2S |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | methyl 2-(1,3-thiazol-2-ylmethyl)butanoate |
| SMILES | CCC(Cc1nccs1)C(=O)OC |
| InChI | InChI=1S/C9H13NO2S/c1-3-7(9(11)12-2)6-8-10-4-5-13-8/h4-5,7H,3,6H2,1-2H3 |
| InChIKey | DFPVLUXCZGZBQW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |