C9H15NO2S — CID 116710804
3-methoxy-1-(1,3-thiazol-2-yl)pentan-2-ol (PubChem CID 116710804) has the molecular formula C9H15NO2S and a molecular weight of 201.29 g/mol. Its IUPAC name is 3-methoxy-1-(1,3-thiazol-2-yl)pentan-2-ol.
| Compound Name | 3-methoxy-1-(1,3-thiazol-2-yl)pentan-2-ol |
|---|---|
| PubChem CID | 116710804 |
| Molecular Formula | C9H15NO2S |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 3-methoxy-1-(1,3-thiazol-2-yl)pentan-2-ol |
| SMILES | CCC(OC)C(O)Cc1nccs1 |
| InChI | InChI=1S/C9H15NO2S/c1-3-8(12-2)7(11)6-9-10-4-5-13-9/h4-5,7-8,11H,3,6H2,1-2H3 |
| InChIKey | JEQCTLRISRQAQY-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |