C10H17NO2S — CID 105115330
5-methoxy-4-methyl-1-(1,3-thiazol-2-yl)pentan-2-ol (PubChem CID 105115330) has the molecular formula C10H17NO2S and a molecular weight of 215.32 g/mol. Its IUPAC name is 5-methoxy-4-methyl-1-(1,3-thiazol-2-yl)pentan-2-ol.
| Compound Name | 5-methoxy-4-methyl-1-(1,3-thiazol-2-yl)pentan-2-ol |
|---|---|
| PubChem CID | 105115330 |
| Molecular Formula | C10H17NO2S |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | 5-methoxy-4-methyl-1-(1,3-thiazol-2-yl)pentan-2-ol |
| SMILES | COCC(C)CC(O)Cc1nccs1 |
| InChI | InChI=1S/C10H17NO2S/c1-8(7-13-2)5-9(12)6-10-11-3-4-14-10/h3-4,8-9,12H,5-7H2,1-2H3 |
| InChIKey | UWTGLCUUCXZTDN-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |