C8H14N2OS — CID 79819993
1-(ethylamino)-3-(1,3-thiazol-2-yl)propan-2-ol (PubChem CID 79819993) has the molecular formula C8H14N2OS and a molecular weight of 186.28 g/mol. Its IUPAC name is 1-(ethylamino)-3-(1,3-thiazol-2-yl)propan-2-ol.
| Compound Name | 1-(ethylamino)-3-(1,3-thiazol-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 79819993 |
| Molecular Formula | C8H14N2OS |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 1-(ethylamino)-3-(1,3-thiazol-2-yl)propan-2-ol |
| SMILES | CCNCC(O)Cc1nccs1 |
| InChI | InChI=1S/C8H14N2OS/c1-2-9-6-7(11)5-8-10-3-4-12-8/h3-4,7,9,11H,2,5-6H2,1H3 |
| InChIKey | GFOVVCXBGSJYPR-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |