C11H20N2OS — CID 79823797
4-(diethylamino)-1-(1,3-thiazol-2-yl)butan-2-ol (PubChem CID 79823797) has the molecular formula C11H20N2OS and a molecular weight of 228.36 g/mol. Its IUPAC name is 4-(diethylamino)-1-(1,3-thiazol-2-yl)butan-2-ol.
| Compound Name | 4-(diethylamino)-1-(1,3-thiazol-2-yl)butan-2-ol |
|---|---|
| PubChem CID | 79823797 |
| Molecular Formula | C11H20N2OS |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 4-(diethylamino)-1-(1,3-thiazol-2-yl)butan-2-ol |
| SMILES | CCN(CC)CCC(O)Cc1nccs1 |
| InChI | InChI=1S/C11H20N2OS/c1-3-13(4-2)7-5-10(14)9-11-12-6-8-15-11/h6,8,10,14H,3-5,7,9H2,1-2H3 |
| InChIKey | FNDUTJWEUWVTIC-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |