C10H13N3S2 — CID 70991421
N,N-bis(1,3-thiazol-2-ylmethyl)ethanamine (PubChem CID 70991421) has the molecular formula C10H13N3S2 and a molecular weight of 239.37 g/mol. Its IUPAC name is N,N-bis(1,3-thiazol-2-ylmethyl)ethanamine.
| Compound Name | N,N-bis(1,3-thiazol-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 70991421 |
| Molecular Formula | C10H13N3S2 |
| Molecular Weight | 239.37 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | N,N-bis(1,3-thiazol-2-ylmethyl)ethanamine |
| SMILES | CCN(Cc1nccs1)Cc1nccs1 |
| InChI | InChI=1S/C10H13N3S2/c1-2-13(7-9-11-3-5-14-9)8-10-12-4-6-15-10/h3-6H,2,7-8H2,1H3 |
| InChIKey | RRXYAAHKDIARRX-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |