About N,N-bis(1,3-thiazol-2-ylmethyl)ethanamine
N,N-bis(1,3-thiazol-2-ylmethyl)ethanamine (PubChem CID 70991421) has the molecular formula C10H13N3S2
and a molecular weight of 239.37 g/mol. Its IUPAC name is N,N-bis(1,3-thiazol-2-ylmethyl)ethanamine.
Molecular Properties
| Compound Name | N,N-bis(1,3-thiazol-2-ylmethyl)ethanamine |
| PubChem CID | 70991421 |
| Molecular Formula | C10H13N3S2 |
| Molecular Weight | 239.37 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | N,N-bis(1,3-thiazol-2-ylmethyl)ethanamine |
| SMILES | CCN(Cc1nccs1)Cc1nccs1 |
| InChI | InChI=1S/C10H13N3S2/c1-2-13(7-9-11-3-5-14-9)8-10-12-4-6-15-10/h3-6H,2,7-8H2,1H3 |
| InChIKey | RRXYAAHKDIARRX-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N,N-bis(1,3-thiazol-2-ylmethyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-bis(1,3-thiazol-2-ylmethyl)ethanamine?
The IUPAC name of N,N-bis(1,3-thiazol-2-ylmethyl)ethanamine (CID 70991421) is N,N-bis(1,3-thiazol-2-ylmethyl)ethanamine.
What is the SMILES notation for N,N-bis(1,3-thiazol-2-ylmethyl)ethanamine?
The canonical SMILES for N,N-bis(1,3-thiazol-2-ylmethyl)ethanamine is CCN(Cc1nccs1)Cc1nccs1.
What is the InChIKey of N,N-bis(1,3-thiazol-2-ylmethyl)ethanamine?
The InChIKey is RRXYAAHKDIARRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3S2/c1-2-13(7-9-11-3-5-14-9)8-10-12-4-6-15-10/h3-6H,2,7-8H2,1H3.
What are the key properties of N,N-bis(1,3-thiazol-2-ylmethyl)ethanamine?
N,N-bis(1,3-thiazol-2-ylmethyl)ethanamine has a molecular weight of 239.37 g/mol, XLogP of 2.62, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-bis(1,3-thiazol-2-ylmethyl)ethanamine is sourced from PubChem (CID 70991421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).