C6H4N2S3 — CID 608243
2-(1,3-thiazol-2-ylsulfanyl)-1,3-thiazole (PubChem CID 608243) has the molecular formula C6H4N2S3 and a molecular weight of 200.31 g/mol. Its IUPAC name is 2-(1,3-thiazol-2-ylsulfanyl)-1,3-thiazole.
| Compound Name | 2-(1,3-thiazol-2-ylsulfanyl)-1,3-thiazole |
|---|---|
| PubChem CID | 608243 |
| Molecular Formula | C6H4N2S3 |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 199.95 |
| IUPAC Name | 2-(1,3-thiazol-2-ylsulfanyl)-1,3-thiazole |
| SMILES | c1csc(Sc2nccs2)n1 |
| InChI | InChI=1S/C6H4N2S3/c1-3-9-5(7-1)11-6-8-2-4-10-6/h1-4H |
| InChIKey | FJHMSXKNZYCLRN-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|