C7H6N2S2 — CID 642343
2-(1,3-thiazol-2-ylmethyl)-1,3-thiazole (PubChem CID 642343) has the molecular formula C7H6N2S2 and a molecular weight of 182.27 g/mol. Its IUPAC name is 2-(1,3-thiazol-2-ylmethyl)-1,3-thiazole.
| Compound Name | 2-(1,3-thiazol-2-ylmethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 642343 |
| Molecular Formula | C7H6N2S2 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.00 |
| IUPAC Name | 2-(1,3-thiazol-2-ylmethyl)-1,3-thiazole |
| SMILES | c1csc(Cc2nccs2)n1 |
| InChI | InChI=1S/C7H6N2S2/c1-3-10-6(8-1)5-7-9-2-4-11-7/h1-4H,5H2 |
| InChIKey | QMGVWSJNPMFIJO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |