C11H19NO2S — CID 116711385
3-ethoxy-1-(1,3-thiazol-2-yl)hexan-2-ol (PubChem CID 116711385) has the molecular formula C11H19NO2S and a molecular weight of 229.34 g/mol. Its IUPAC name is 3-ethoxy-1-(1,3-thiazol-2-yl)hexan-2-ol.
| Compound Name | 3-ethoxy-1-(1,3-thiazol-2-yl)hexan-2-ol |
|---|---|
| PubChem CID | 116711385 |
| Molecular Formula | C11H19NO2S |
| Molecular Weight | 229.34 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 3-ethoxy-1-(1,3-thiazol-2-yl)hexan-2-ol |
| SMILES | CCCC(OCC)C(O)Cc1nccs1 |
| InChI | InChI=1S/C11H19NO2S/c1-3-5-10(14-4-2)9(13)8-11-12-6-7-15-11/h6-7,9-10,13H,3-5,8H2,1-2H3 |
| InChIKey | YOFZNLNRMATQGA-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |