C11H21N3OS — CID 105271499
[3-ethoxy-1-(1,3-thiazol-2-yl)hexan-2-yl]hydrazine (PubChem CID 105271499) has the molecular formula C11H21N3OS and a molecular weight of 243.38 g/mol. Its IUPAC name is [3-ethoxy-1-(1,3-thiazol-2-yl)hexan-2-yl]hydrazine.
| Compound Name | [3-ethoxy-1-(1,3-thiazol-2-yl)hexan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105271499 |
| Molecular Formula | C11H21N3OS |
| Molecular Weight | 243.38 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | [3-ethoxy-1-(1,3-thiazol-2-yl)hexan-2-yl]hydrazine |
| SMILES | CCCC(OCC)C(Cc1nccs1)NN |
| InChI | InChI=1S/C11H21N3OS/c1-3-5-10(15-4-2)9(14-12)8-11-13-6-7-16-11/h6-7,9-10,14H,3-5,8,12H2,1-2H3 |
| InChIKey | RFKCRWPWHVPDDD-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.38 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|