C13H24N2OS — CID 116717963
3-ethoxy-N-ethyl-1-(1,3-thiazol-2-yl)hexan-2-amine (PubChem CID 116717963) has the molecular formula C13H24N2OS and a molecular weight of 256.41 g/mol. Its IUPAC name is 3-ethoxy-N-ethyl-1-(1,3-thiazol-2-yl)hexan-2-amine.
| Compound Name | 3-ethoxy-N-ethyl-1-(1,3-thiazol-2-yl)hexan-2-amine |
|---|---|
| PubChem CID | 116717963 |
| Molecular Formula | C13H24N2OS |
| Molecular Weight | 256.41 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 3-ethoxy-N-ethyl-1-(1,3-thiazol-2-yl)hexan-2-amine |
| SMILES | CCCC(OCC)C(Cc1nccs1)NCC |
| InChI | InChI=1S/C13H24N2OS/c1-4-7-12(16-6-3)11(14-5-2)10-13-15-8-9-17-13/h8-9,11-12,14H,4-7,10H2,1-3H3 |
| InChIKey | SMCBVGSLMCLINA-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |