C11H20N2OS — CID 116715655
N-ethyl-3-methoxy-1-(1,3-thiazol-2-yl)pentan-2-amine (PubChem CID 116715655) has the molecular formula C11H20N2OS and a molecular weight of 228.36 g/mol. Its IUPAC name is N-ethyl-3-methoxy-1-(1,3-thiazol-2-yl)pentan-2-amine.
| Compound Name | N-ethyl-3-methoxy-1-(1,3-thiazol-2-yl)pentan-2-amine |
|---|---|
| PubChem CID | 116715655 |
| Molecular Formula | C11H20N2OS |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | N-ethyl-3-methoxy-1-(1,3-thiazol-2-yl)pentan-2-amine |
| SMILES | CCNC(Cc1nccs1)C(CC)OC |
| InChI | InChI=1S/C11H20N2OS/c1-4-10(14-3)9(12-5-2)8-11-13-6-7-15-11/h6-7,9-10,12H,4-5,8H2,1-3H3 |
| InChIKey | RBOIKMHYQWNCRI-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |