C9H16N2OS — CID 116715056
3-methoxy-1-(1,3-thiazol-2-yl)pentan-2-amine (PubChem CID 116715056) has the molecular formula C9H16N2OS and a molecular weight of 200.31 g/mol. Its IUPAC name is 3-methoxy-1-(1,3-thiazol-2-yl)pentan-2-amine.
| Compound Name | 3-methoxy-1-(1,3-thiazol-2-yl)pentan-2-amine |
|---|---|
| PubChem CID | 116715056 |
| Molecular Formula | C9H16N2OS |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 3-methoxy-1-(1,3-thiazol-2-yl)pentan-2-amine |
| SMILES | CCC(OC)C(N)Cc1nccs1 |
| InChI | InChI=1S/C9H16N2OS/c1-3-8(12-2)7(10)6-9-11-4-5-13-9/h4-5,7-8H,3,6,10H2,1-2H3 |
| InChIKey | VAMXMAZLMSMJMY-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |