C13H24N2S — CID 105014894
3,4-dimethyl-N-propyl-1-(1,3-thiazol-2-yl)pentan-2-amine (PubChem CID 105014894) has the molecular formula C13H24N2S and a molecular weight of 240.42 g/mol. Its IUPAC name is 3,4-dimethyl-N-propyl-1-(1,3-thiazol-2-yl)pentan-2-amine.
| Compound Name | 3,4-dimethyl-N-propyl-1-(1,3-thiazol-2-yl)pentan-2-amine |
|---|---|
| PubChem CID | 105014894 |
| Molecular Formula | C13H24N2S |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 3,4-dimethyl-N-propyl-1-(1,3-thiazol-2-yl)pentan-2-amine |
| SMILES | CCCNC(Cc1nccs1)C(C)C(C)C |
| InChI | InChI=1S/C13H24N2S/c1-5-6-14-12(11(4)10(2)3)9-13-15-7-8-16-13/h7-8,10-12,14H,5-6,9H2,1-4H3 |
| InChIKey | NPUVUIRLBGCAIG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |