C8H15N3S — CID 105199664
[3-methyl-1-(1,3-thiazol-2-yl)butan-2-yl]hydrazine (PubChem CID 105199664) has the molecular formula C8H15N3S and a molecular weight of 185.30 g/mol. Its IUPAC name is [3-methyl-1-(1,3-thiazol-2-yl)butan-2-yl]hydrazine.
| Compound Name | [3-methyl-1-(1,3-thiazol-2-yl)butan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105199664 |
| Molecular Formula | C8H15N3S |
| Molecular Weight | 185.30 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | [3-methyl-1-(1,3-thiazol-2-yl)butan-2-yl]hydrazine |
| SMILES | CC(C)C(Cc1nccs1)NN |
| InChI | InChI=1S/C8H15N3S/c1-6(2)7(11-9)5-8-10-3-4-12-8/h3-4,6-7,11H,5,9H2,1-2H3 |
| InChIKey | ZNYYKUVOXKEDOF-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.30 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|