C12H23N3OS — CID 105275180
[3-ethoxy-3-ethyl-1-(1,3-thiazol-2-yl)pentan-2-yl]hydrazine (PubChem CID 105275180) has the molecular formula C12H23N3OS and a molecular weight of 257.40 g/mol. Its IUPAC name is [3-ethoxy-3-ethyl-1-(1,3-thiazol-2-yl)pentan-2-yl]hydrazine.
| Compound Name | [3-ethoxy-3-ethyl-1-(1,3-thiazol-2-yl)pentan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105275180 |
| Molecular Formula | C12H23N3OS |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | [3-ethoxy-3-ethyl-1-(1,3-thiazol-2-yl)pentan-2-yl]hydrazine |
| SMILES | CCOC(CC)(CC)C(Cc1nccs1)NN |
| InChI | InChI=1S/C12H23N3OS/c1-4-12(5-2,16-6-3)10(15-13)9-11-14-7-8-17-11/h7-8,10,15H,4-6,9,13H2,1-3H3 |
| InChIKey | NPKSOSDHYVZHNT-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|