C13H24N4S — CID 105241191
[3-methyl-3-pyrrolidin-1-yl-1-(1,3-thiazol-2-yl)pentan-2-yl]hydrazine (PubChem CID 105241191) has the molecular formula C13H24N4S and a molecular weight of 268.43 g/mol. Its IUPAC name is [3-methyl-3-pyrrolidin-1-yl-1-(1,3-thiazol-2-yl)pentan-2-yl]hydrazine.
| Compound Name | [3-methyl-3-pyrrolidin-1-yl-1-(1,3-thiazol-2-yl)pentan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105241191 |
| Molecular Formula | C13H24N4S |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | [3-methyl-3-pyrrolidin-1-yl-1-(1,3-thiazol-2-yl)pentan-2-yl]hydrazine |
| SMILES | CCC(C)(C(Cc1nccs1)NN)N1CCCC1 |
| InChI | InChI=1S/C13H24N4S/c1-3-13(2,17-7-4-5-8-17)11(16-14)10-12-15-6-9-18-12/h6,9,11,16H,3-5,7-8,10,14H2,1-2H3 |
| InChIKey | XPGDEBABWHCBDT-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|