C16H30N4S — CID 105241262
[1-(4,5-dimethyl-1,3-thiazol-2-yl)-3-methyl-3-piperidin-1-ylpentan-2-yl]hydrazine (PubChem CID 105241262) has the molecular formula C16H30N4S and a molecular weight of 310.51 g/mol. Its IUPAC name is [1-(4,5-dimethyl-1,3-thiazol-2-yl)-3-methyl-3-piperidin-1-ylpentan-2-yl]hydrazine.
| Compound Name | [1-(4,5-dimethyl-1,3-thiazol-2-yl)-3-methyl-3-piperidin-1-ylpentan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105241262 |
| Molecular Formula | C16H30N4S |
| Molecular Weight | 310.51 g/mol |
| Exact Mass | 310.22 |
| IUPAC Name | [1-(4,5-dimethyl-1,3-thiazol-2-yl)-3-methyl-3-piperidin-1-ylpentan-2-yl]hydrazine |
| SMILES | CCC(C)(C(Cc1nc(C)c(C)s1)NN)N1CCCCC1 |
| InChI | InChI=1S/C16H30N4S/c1-5-16(4,20-9-7-6-8-10-20)14(19-17)11-15-18-12(2)13(3)21-15/h14,19H,5-11,17H2,1-4H3 |
| InChIKey | DSTBKPPOACOSNA-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.51 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|