C15H30N4S — CID 105240784
1-(4,5-dimethyl-1,3-thiazol-2-yl)-N,N-diethyl-2-hydrazinyl-3-methylpentan-3-amine (PubChem CID 105240784) has the molecular formula C15H30N4S and a molecular weight of 298.50 g/mol. Its IUPAC name is 1-(4,5-dimethyl-1,3-thiazol-2-yl)-N,N-diethyl-2-hydrazinyl-3-methylpentan-3-amine.
| Compound Name | 1-(4,5-dimethyl-1,3-thiazol-2-yl)-N,N-diethyl-2-hydrazinyl-3-methylpentan-3-amine |
|---|---|
| PubChem CID | 105240784 |
| Molecular Formula | C15H30N4S |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | 1-(4,5-dimethyl-1,3-thiazol-2-yl)-N,N-diethyl-2-hydrazinyl-3-methylpentan-3-amine |
| SMILES | CCN(CC)C(C)(CC)C(Cc1nc(C)c(C)s1)NN |
| InChI | InChI=1S/C15H30N4S/c1-7-15(6,19(8-2)9-3)13(18-16)10-14-17-11(4)12(5)20-14/h13,18H,7-10,16H2,1-6H3 |
| InChIKey | BMHYCSIPCCMYLM-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.50 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|