C13H23N3OS — CID 105272985
[1-cyclopropyl-3-(4,5-dimethyl-1,3-thiazol-2-yl)-1-ethoxypropan-2-yl]hydrazine (PubChem CID 105272985) has the molecular formula C13H23N3OS and a molecular weight of 269.41 g/mol. Its IUPAC name is [1-cyclopropyl-3-(4,5-dimethyl-1,3-thiazol-2-yl)-1-ethoxypropan-2-yl]hydrazine.
| Compound Name | [1-cyclopropyl-3-(4,5-dimethyl-1,3-thiazol-2-yl)-1-ethoxypropan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105272985 |
| Molecular Formula | C13H23N3OS |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | [1-cyclopropyl-3-(4,5-dimethyl-1,3-thiazol-2-yl)-1-ethoxypropan-2-yl]hydrazine |
| SMILES | CCOC(C1CC1)C(Cc1nc(C)c(C)s1)NN |
| InChI | InChI=1S/C13H23N3OS/c1-4-17-13(10-5-6-10)11(16-14)7-12-15-8(2)9(3)18-12/h10-11,13,16H,4-7,14H2,1-3H3 |
| InChIKey | LUEQBIVOMVOIBC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|