C12H23N3OS — CID 105273954
[1-(4,5-dimethyl-1,3-thiazol-2-yl)-3-ethoxy-3-methylbutan-2-yl]hydrazine (PubChem CID 105273954) has the molecular formula C12H23N3OS and a molecular weight of 257.40 g/mol. Its IUPAC name is [1-(4,5-dimethyl-1,3-thiazol-2-yl)-3-ethoxy-3-methylbutan-2-yl]hydrazine.
| Compound Name | [1-(4,5-dimethyl-1,3-thiazol-2-yl)-3-ethoxy-3-methylbutan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105273954 |
| Molecular Formula | C12H23N3OS |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | [1-(4,5-dimethyl-1,3-thiazol-2-yl)-3-ethoxy-3-methylbutan-2-yl]hydrazine |
| SMILES | CCOC(C)(C)C(Cc1nc(C)c(C)s1)NN |
| InChI | InChI=1S/C12H23N3OS/c1-6-16-12(4,5)10(15-13)7-11-14-8(2)9(3)17-11/h10,15H,6-7,13H2,1-5H3 |
| InChIKey | AKVQINOFJUHNBJ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|