C15H26N2O — CID 105274027
[1-(3,5-dimethylphenyl)-3-ethoxy-3-methylbutan-2-yl]hydrazine (PubChem CID 105274027) has the molecular formula C15H26N2O and a molecular weight of 250.39 g/mol. Its IUPAC name is [1-(3,5-dimethylphenyl)-3-ethoxy-3-methylbutan-2-yl]hydrazine.
| Compound Name | [1-(3,5-dimethylphenyl)-3-ethoxy-3-methylbutan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105274027 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | [1-(3,5-dimethylphenyl)-3-ethoxy-3-methylbutan-2-yl]hydrazine |
| SMILES | CCOC(C)(C)C(Cc1cc(C)cc(C)c1)NN |
| InChI | InChI=1S/C15H26N2O/c1-6-18-15(4,5)14(17-16)10-13-8-11(2)7-12(3)9-13/h7-9,14,17H,6,10,16H2,1-5H3 |
| InChIKey | XIBBZPODRPERNM-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|