C11H15ClF2N2 — CID 105265411
[1-chloro-3-(3,5-dimethylphenyl)-1,1-difluoropropan-2-yl]hydrazine (PubChem CID 105265411) has the molecular formula C11H15ClF2N2 and a molecular weight of 248.70 g/mol. Its IUPAC name is [1-chloro-3-(3,5-dimethylphenyl)-1,1-difluoropropan-2-yl]hydrazine.
| Compound Name | [1-chloro-3-(3,5-dimethylphenyl)-1,1-difluoropropan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105265411 |
| Molecular Formula | C11H15ClF2N2 |
| Molecular Weight | 248.70 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | [1-chloro-3-(3,5-dimethylphenyl)-1,1-difluoropropan-2-yl]hydrazine |
| SMILES | Cc1cc(C)cc(CC(NN)C(F)(F)Cl)c1 |
| InChI | InChI=1S/C11H15ClF2N2/c1-7-3-8(2)5-9(4-7)6-10(16-15)11(12,13)14/h3-5,10,16H,6,15H2,1-2H3 |
| InChIKey | HUFSBNRRRYAWGQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.70 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|