C10H13F3N2 — CID 105215650
[1,1,1-trifluoro-3-(3-methylphenyl)propan-2-yl]hydrazine (PubChem CID 105215650) has the molecular formula C10H13F3N2 and a molecular weight of 218.22 g/mol. Its IUPAC name is [1,1,1-trifluoro-3-(3-methylphenyl)propan-2-yl]hydrazine.
| Compound Name | [1,1,1-trifluoro-3-(3-methylphenyl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105215650 |
| Molecular Formula | C10H13F3N2 |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | [1,1,1-trifluoro-3-(3-methylphenyl)propan-2-yl]hydrazine |
| SMILES | Cc1cccc(CC(NN)C(F)(F)F)c1 |
| InChI | InChI=1S/C10H13F3N2/c1-7-3-2-4-8(5-7)6-9(15-14)10(11,12)13/h2-5,9,15H,6,14H2,1H3 |
| InChIKey | QJPATSAUZOOQFG-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|