C12H17F3N2 — CID 105215820
[1,1,1-trifluoro-3-(2,4,6-trimethylphenyl)propan-2-yl]hydrazine (PubChem CID 105215820) has the molecular formula C12H17F3N2 and a molecular weight of 246.28 g/mol. Its IUPAC name is [1,1,1-trifluoro-3-(2,4,6-trimethylphenyl)propan-2-yl]hydrazine.
| Compound Name | [1,1,1-trifluoro-3-(2,4,6-trimethylphenyl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105215820 |
| Molecular Formula | C12H17F3N2 |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | [1,1,1-trifluoro-3-(2,4,6-trimethylphenyl)propan-2-yl]hydrazine |
| SMILES | Cc1cc(C)c(CC(NN)C(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C12H17F3N2/c1-7-4-8(2)10(9(3)5-7)6-11(17-16)12(13,14)15/h4-5,11,17H,6,16H2,1-3H3 |
| InChIKey | BOCAKLCOOYZMMY-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|