C18H32N2 — CID 105197851
[1-(4-tert-butyl-2,6-dimethylphenyl)-3,3-dimethylbutan-2-yl]hydrazine (PubChem CID 105197851) has the molecular formula C18H32N2 and a molecular weight of 276.47 g/mol. Its IUPAC name is [1-(4-tert-butyl-2,6-dimethylphenyl)-3,3-dimethylbutan-2-yl]hydrazine.
| Compound Name | [1-(4-tert-butyl-2,6-dimethylphenyl)-3,3-dimethylbutan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105197851 |
| Molecular Formula | C18H32N2 |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.26 |
| IUPAC Name | [1-(4-tert-butyl-2,6-dimethylphenyl)-3,3-dimethylbutan-2-yl]hydrazine |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1CC(NN)C(C)(C)C |
| InChI | InChI=1S/C18H32N2/c1-12-9-14(17(3,4)5)10-13(2)15(12)11-16(20-19)18(6,7)8/h9-10,16,20H,11,19H2,1-8H3 |
| InChIKey | ZMSLZUJNMWZERS-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|