C16H26N2 — CID 105197829
1-(4-tert-butyl-2,6-dimethylphenyl)but-3-en-2-ylhydrazine (PubChem CID 105197829) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is 1-(4-tert-butyl-2,6-dimethylphenyl)but-3-en-2-ylhydrazine.
| Compound Name | 1-(4-tert-butyl-2,6-dimethylphenyl)but-3-en-2-ylhydrazine |
|---|---|
| PubChem CID | 105197829 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 1-(4-tert-butyl-2,6-dimethylphenyl)but-3-en-2-ylhydrazine |
| SMILES | C=CC(Cc1c(C)cc(C(C)(C)C)cc1C)NN |
| InChI | InChI=1S/C16H26N2/c1-7-14(18-17)10-15-11(2)8-13(9-12(15)3)16(4,5)6/h7-9,14,18H,1,10,17H2,2-6H3 |
| InChIKey | RTRHGNADTZLPHI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|