C20H33N — CID 63413264
1-(4-tert-butyl-2,6-dimethylphenyl)-N-propylpent-4-en-2-amine (PubChem CID 63413264) has the molecular formula C20H33N and a molecular weight of 287.49 g/mol. Its IUPAC name is 1-(4-tert-butyl-2,6-dimethylphenyl)-N-propylpent-4-en-2-amine.
| Compound Name | 1-(4-tert-butyl-2,6-dimethylphenyl)-N-propylpent-4-en-2-amine |
|---|---|
| PubChem CID | 63413264 |
| Molecular Formula | C20H33N |
| Molecular Weight | 287.49 g/mol |
| Exact Mass | 287.26 |
| IUPAC Name | 1-(4-tert-butyl-2,6-dimethylphenyl)-N-propylpent-4-en-2-amine |
| SMILES | C=CCC(Cc1c(C)cc(C(C)(C)C)cc1C)NCCC |
| InChI | InChI=1S/C20H33N/c1-8-10-18(21-11-9-2)14-19-15(3)12-17(13-16(19)4)20(5,6)7/h8,12-13,18,21H,1,9-11,14H2,2-7H3 |
| InChIKey | YYHBTMLCCMLNGN-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.49 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|