C10H19N — CID 88756960
N-propylhepta-1,6-dien-4-amine (PubChem CID 88756960) has the molecular formula C10H19N and a molecular weight of 153.27 g/mol. Its IUPAC name is N-propylhepta-1,6-dien-4-amine.
| Compound Name | N-propylhepta-1,6-dien-4-amine |
|---|---|
| PubChem CID | 88756960 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | N-propylhepta-1,6-dien-4-amine |
| SMILES | C=CCC(CC=C)NCCC |
| InChI | InChI=1S/C10H19N/c1-4-7-10(8-5-2)11-9-6-3/h4-5,10-11H,1-2,6-9H2,3H3 |
| InChIKey | CXNYCVCFCQTFMS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|