C19H38ClN — CID 175149867
N-hepta-1,6-dien-4-yldodecan-1-amine;hydrochloride (PubChem CID 175149867) has the molecular formula C19H38ClN and a molecular weight of 315.97 g/mol. Its IUPAC name is N-hepta-1,6-dien-4-yldodecan-1-amine;hydrochloride.
| Compound Name | N-hepta-1,6-dien-4-yldodecan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 175149867 |
| Molecular Formula | C19H38ClN |
| Molecular Weight | 315.97 g/mol |
| Exact Mass | 315.27 |
| IUPAC Name | N-hepta-1,6-dien-4-yldodecan-1-amine;hydrochloride |
| SMILES | C=CCC(CC=C)NCCCCCCCCCCCC.Cl |
| InChI | InChI=1S/C19H37N.ClH/c1-4-7-8-9-10-11-12-13-14-15-18-20-19(16-5-2)17-6-3;/h5-6,19-20H,2-4,7-18H2,1H3;1H |
| InChIKey | RZJWKQCUMKUMBN-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.97 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|