C18H28N2 — CID 105197839
1-(4-tert-butyl-2,6-dimethylphenyl)hex-5-yn-2-ylhydrazine (PubChem CID 105197839) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is 1-(4-tert-butyl-2,6-dimethylphenyl)hex-5-yn-2-ylhydrazine.
| Compound Name | 1-(4-tert-butyl-2,6-dimethylphenyl)hex-5-yn-2-ylhydrazine |
|---|---|
| PubChem CID | 105197839 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | 1-(4-tert-butyl-2,6-dimethylphenyl)hex-5-yn-2-ylhydrazine |
| SMILES | C#CCCC(Cc1c(C)cc(C(C)(C)C)cc1C)NN |
| InChI | InChI=1S/C18H28N2/c1-7-8-9-16(20-19)12-17-13(2)10-15(11-14(17)3)18(4,5)6/h1,10-11,16,20H,8-9,12,19H2,2-6H3 |
| InChIKey | DUSYHQDFQINZJA-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|