C18H30N2 — CID 105197853
[1-(4-tert-butyl-2,6-dimethylphenyl)-4-methylpent-4-en-2-yl]hydrazine (PubChem CID 105197853) has the molecular formula C18H30N2 and a molecular weight of 274.45 g/mol. Its IUPAC name is [1-(4-tert-butyl-2,6-dimethylphenyl)-4-methylpent-4-en-2-yl]hydrazine.
| Compound Name | [1-(4-tert-butyl-2,6-dimethylphenyl)-4-methylpent-4-en-2-yl]hydrazine |
|---|---|
| PubChem CID | 105197853 |
| Molecular Formula | C18H30N2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | [1-(4-tert-butyl-2,6-dimethylphenyl)-4-methylpent-4-en-2-yl]hydrazine |
| SMILES | C=C(C)CC(Cc1c(C)cc(C(C)(C)C)cc1C)NN |
| InChI | InChI=1S/C18H30N2/c1-12(2)8-16(20-19)11-17-13(3)9-15(10-14(17)4)18(5,6)7/h9-10,16,20H,1,8,11,19H2,2-7H3 |
| InChIKey | PUMHUJQETXRBAR-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|