About 1-(4-tert-butyl-2,6-dimethylphenyl)hex-4-yn-2-ylhydrazine
1-(4-tert-butyl-2,6-dimethylphenyl)hex-4-yn-2-ylhydrazine (PubChem CID 105197832) has the molecular formula C18H28N2
and a molecular weight of 272.44 g/mol. Its IUPAC name is 1-(4-tert-butyl-2,6-dimethylphenyl)hex-4-yn-2-ylhydrazine.
Molecular Properties
| Compound Name | 1-(4-tert-butyl-2,6-dimethylphenyl)hex-4-yn-2-ylhydrazine |
| PubChem CID | 105197832 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | 1-(4-tert-butyl-2,6-dimethylphenyl)hex-4-yn-2-ylhydrazine |
| SMILES | CC#CCC(Cc1c(C)cc(C(C)(C)C)cc1C)NN |
| InChI | InChI=1S/C18H28N2/c1-7-8-9-16(20-19)12-17-13(2)10-15(11-14(17)3)18(4,5)6/h10-11,16,20H,9,12,19H2,1-6H3 |
| InChIKey | SERQPLJYFTXPRN-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-tert-butyl-2,6-dimethylphenyl)hex-4-yn-2-ylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-tert-butyl-2,6-dimethylphenyl)hex-4-yn-2-ylhydrazine?
The IUPAC name of 1-(4-tert-butyl-2,6-dimethylphenyl)hex-4-yn-2-ylhydrazine (CID 105197832) is 1-(4-tert-butyl-2,6-dimethylphenyl)hex-4-yn-2-ylhydrazine.
What is the SMILES notation for 1-(4-tert-butyl-2,6-dimethylphenyl)hex-4-yn-2-ylhydrazine?
The canonical SMILES for 1-(4-tert-butyl-2,6-dimethylphenyl)hex-4-yn-2-ylhydrazine is CC#CCC(Cc1c(C)cc(C(C)(C)C)cc1C)NN.
What is the InChIKey of 1-(4-tert-butyl-2,6-dimethylphenyl)hex-4-yn-2-ylhydrazine?
The InChIKey is SERQPLJYFTXPRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28N2/c1-7-8-9-16(20-19)12-17-13(2)10-15(11-14(17)3)18(4,5)6/h10-11,16,20H,9,12,19H2,1-6H3.
What are the key properties of 1-(4-tert-butyl-2,6-dimethylphenyl)hex-4-yn-2-ylhydrazine?
1-(4-tert-butyl-2,6-dimethylphenyl)hex-4-yn-2-ylhydrazine has a molecular weight of 272.44 g/mol, XLogP of 3.39, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-tert-butyl-2,6-dimethylphenyl)hex-4-yn-2-ylhydrazine is sourced from PubChem (CID 105197832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).