C10H14N2S — CID 105211808
1-thiophen-2-ylhex-4-yn-2-ylhydrazine (PubChem CID 105211808) has the molecular formula C10H14N2S and a molecular weight of 194.30 g/mol. Its IUPAC name is 1-thiophen-2-ylhex-4-yn-2-ylhydrazine.
| Compound Name | 1-thiophen-2-ylhex-4-yn-2-ylhydrazine |
|---|---|
| PubChem CID | 105211808 |
| Molecular Formula | C10H14N2S |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 1-thiophen-2-ylhex-4-yn-2-ylhydrazine |
| SMILES | CC#CCC(Cc1cccs1)NN |
| InChI | InChI=1S/C10H14N2S/c1-2-3-5-9(12-11)8-10-6-4-7-13-10/h4,6-7,9,12H,5,8,11H2,1H3 |
| InChIKey | OWFFELAXXCGNFL-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|