C7H10F2N2S — CID 105265228
(1,1-difluoro-3-thiophen-2-ylpropan-2-yl)hydrazine (PubChem CID 105265228) has the molecular formula C7H10F2N2S and a molecular weight of 192.23 g/mol. Its IUPAC name is (1,1-difluoro-3-thiophen-2-ylpropan-2-yl)hydrazine.
| Compound Name | (1,1-difluoro-3-thiophen-2-ylpropan-2-yl)hydrazine |
|---|---|
| PubChem CID | 105265228 |
| Molecular Formula | C7H10F2N2S |
| Molecular Weight | 192.23 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | (1,1-difluoro-3-thiophen-2-ylpropan-2-yl)hydrazine |
| SMILES | NNC(Cc1cccs1)C(F)F |
| InChI | InChI=1S/C7H10F2N2S/c8-7(9)6(11-10)4-5-2-1-3-12-5/h1-3,6-7,11H,4,10H2 |
| InChIKey | YBMPOYGYSJRRDR-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.23 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|