C11H18N2OS — CID 105211809
[1-(oxan-4-yl)-2-thiophen-2-ylethyl]hydrazine (PubChem CID 105211809) has the molecular formula C11H18N2OS and a molecular weight of 226.34 g/mol. Its IUPAC name is [1-(oxan-4-yl)-2-thiophen-2-ylethyl]hydrazine.
| Compound Name | [1-(oxan-4-yl)-2-thiophen-2-ylethyl]hydrazine |
|---|---|
| PubChem CID | 105211809 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | [1-(oxan-4-yl)-2-thiophen-2-ylethyl]hydrazine |
| SMILES | NNC(Cc1cccs1)C1CCOCC1 |
| InChI | InChI=1S/C11H18N2OS/c12-13-11(8-10-2-1-7-15-10)9-3-5-14-6-4-9/h1-2,7,9,11,13H,3-6,8,12H2 |
| InChIKey | FFRUCIQHCOBAMW-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|